Difference between revisions of "PWY-5353"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15717 CPD-15717] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=34-Dihydroxy-5-Polyprenylbenzoates 34-Dihydroxy-5-Polyprenylbenzoates] == * common name: ** a 3...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=34-Dihydroxy-5-Polyprenylbenzoates 34-Dihydroxy-5-Polyprenylbenzoates] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 3,4-dihydroxy-5-all-trans-polyprenylbenzoate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11757]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 3,4-dihydroxy-5-all-trans-polyprenylbenzoate}} | |
| − | + | {{#set: consumed by=RXN-11757}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 11:01, 18 January 2018
Contents
Metabolite 34-Dihydroxy-5-Polyprenylbenzoates
- common name:
- a 3,4-dihydroxy-5-all-trans-polyprenylbenzoate
- Synonym(s):
