Difference between revisions of "R222-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) * in...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2601 RXN0-2601] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2601 RXN0-2601] ==
−
* smiles:
+
* direction:
−
** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N
+
** [http://enzyme.expasy.org/EC/4.2.99.18 EC-4.2.99.18]
−
* common name:
+
−
** p-nitrophenyl-α-D-galactopyranoside
+
−
* molecular weight:
+
−
** 301.252   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-nitrophenyl-α-D-galactopyranoside
 
−
** 4-nitrophenyl-α-D-galactoside
 
−
** p-nitrophenyl-α-D-galactoside
 
−
** pNPαGal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17830]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Damaged-DNA-Pyrimidine]][c] '''=>''' 1 [[DNA-containing-a-Apyrimidinic-Sites]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a damaged DNA pyrimidine[c] '''=>''' 1 an apyrimidinic site in DNA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00000177001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00000985001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00000546001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=82000 82000]
+
{{#set: ec number=EC-4.2.99.18}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00000177001_1|CHC_T00000985001_1|CHC_T00000546001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=546840 546840]
+
{{#set: in pathway=}}
−
{{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=p-nitrophenyl-α-D-galactopyranoside}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
−
{{#set: molecular weight=301.252    }}
+
−
{{#set: common name=4-nitrophenyl-α-D-galactopyranoside|4-nitrophenyl-α-D-galactoside|p-nitrophenyl-α-D-galactoside|pNPαGal}}
+
−
{{#set: consumed by=RXN-17830}}
+

Revision as of 12:01, 18 January 2018

Reaction RXN0-2601

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=R222-RXN&oldid=5990"