Difference between revisions of "23S-rRNA-uridine2457"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.83-RXN 3.4.21.83-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.83-RXN 3.4.21.83-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.4.21.83 EC-3.4.21.83]
+
** InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
 +
* common name:
 +
** OPC4-CoA
 +
* molecular weight:
 +
** 983.813   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10707]]
−
** 1 [[WATER]][c] '''+''' 1 [[OLIGOPEPTIDES]][c] '''=>''' 1 [[Peptides-holder]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-10700]]
−
** 1 H2O[c] '''+''' 1 an oligopeptide[c] '''=>''' 1 a peptide[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00006531001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P24555 P24555]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237211 44237211]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
−
{{#set: ec number=EC-3.4.21.83}}
+
{{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J}}
−
{{#set: gene associated=CHC_T00006531001_1}}
+
{{#set: common name=OPC4-CoA}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=983.813    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-10707}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-10700}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+

Revision as of 11:01, 18 January 2018

Metabolite CPD-11525

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
  • inchi key:
    • InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
  • common name:
    • OPC4-CoA
  • molecular weight:
    • 983.813
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=23S-rRNA-uridine2457&oldid=5992"