Difference between revisions of "ISOBUTYRATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...")
 
(Created page with "Category:Gene == Gene CHC_T00003487001_1 == * Synonym(s): == Reactions associated == * 2.7.1.152-RXN ** pantograph-galdieria.sulphuraria * RXN-10971 ** ...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] ==
+
== Gene CHC_T00003487001_1 ==
* smiles:
+
** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
+
* inchi key:
+
** InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
+
* common name:
+
** hydroxybupropion
+
* molecular weight:
+
** 256.752   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[2.7.1.152-RXN]]
* [[RXN66-181]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
* [[RXN-10971]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[RXN-10973]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[RXN-10974]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[RXN-4941]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways associated ==
 +
* [[PWY-6369]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=2.7.1.152-RXN|RXN-10971|RXN-10973|RXN-10974|RXN-4941}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202442 25202442]
+
{{#set: pathway associated=PWY-6369}}
* HMDB : HMDB12235
+
{{#set: smiles=CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)}}
+
{{#set: inchi key=InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O}}
+
{{#set: common name=hydroxybupropion}}
+
{{#set: molecular weight=256.752    }}
+
{{#set: produced by=RXN66-181}}
+

Revision as of 12:02, 18 January 2018

Gene CHC_T00003487001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links