Difference between revisions of "ISOBUTYRATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene CHC_T00003487001_1 == * Synonym(s): == Reactions associated == * 2.7.1.152-RXN ** pantograph-galdieria.sulphuraria * RXN-10971 ** ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00003487001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[2.7.1.152-RXN]] | |
− | * [[ | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | == | + | * [[RXN-10971]] |
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[RXN-10973]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[RXN-10974]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[RXN-4941]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6369]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.7.1.152-RXN|RXN-10971|RXN-10973|RXN-10974|RXN-4941}} | |
− | + | {{#set: pathway associated=PWY-6369}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 11:02, 18 January 2018
Gene CHC_T00003487001_1
- Synonym(s):