Difference between revisions of "DIMETHYLSULFONIOACETATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12871 RXN-12871] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12871 RXN-12871] ==
* smiles:
+
* direction:
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=LIEYLSGXGOXYTD-CTBYCIIYSA-M
+
* common name:
+
** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
+
* molecular weight:
+
** 629.941   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
 
** 3-heptaprenyl-4,5-dihydroxybenzoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9287]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-13913]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-13912]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 2-carboxy-L-xylonolactone[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 2-carboxy-L-threo-pentonate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6959]], L-ascorbate degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740353 54740353]
+
{{#set: in pathway=PWY-6959}}
* CHEBI:
+
{{#set: reconstruction category=annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84450 84450]
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C}}
+
{{#set: reconstruction source=original_genome}}
{{#set: inchi key=InChIKey=LIEYLSGXGOXYTD-CTBYCIIYSA-M}}
+
{{#set: common name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: molecular weight=629.941    }}
+
{{#set: common name=3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-heptaprenyl-4,5-dihydroxybenzoate}}
+
{{#set: consumed by=RXN-9287}}
+

Revision as of 12:02, 18 January 2018

Reaction RXN-12871

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 2-carboxy-L-xylonolactone[c] + 1 H2O[c] => 1 H+[c] + 1 2-carboxy-L-threo-pentonate[c]

Genes associated with this reaction

Pathways

  • PWY-6959, L-ascorbate degradation V: PWY-6959
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links