Difference between revisions of "ARGSYNBSUB-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5651 PWY-5651] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5651 PWY-5651] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 
* common name:
 
* common name:
** 4α-methyl-5α-cholesta-8-en-3-one
+
** L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
* '''4''' reaction(s) found
* [[RXN66-18]]
+
** [[KYNURENINE-3-MONOOXYGENASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** [[3-HYDROXY-KYNURENINASE-RXN]]
 +
** [[RXN-8665]]
 +
** [[1.13.11.6-RXN]]
 +
== Reaction(s) not found ==
 +
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=ARYLFORMAMIDASE-RXN ARYLFORMAMIDASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323]
+
{{#set: taxonomic range=TAX-4751}}
* CHEBI:
+
{{#set: taxonomic range=TAX-33208}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050]
+
{{#set: common name=L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde}}
* HMDB : HMDB12174
+
{{#set: reaction found=4}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
+
{{#set: reaction not found=1}}
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
+
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: produced by=RXN66-18}}
+

Revision as of 11:04, 18 January 2018

Pathway PWY-5651

  • taxonomic range:
  • common name:
    • L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links