Difference between revisions of "1CMET2-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5348 PWY-5348] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5348 PWY-5348] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
−
* inchi key:
+
−
** InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K
+
 
* common name:
 
* common name:
−
** all-trans-decaprenyl diphosphate
+
** kaempferol triglucoside biosynthesis
−
* molecular weight:
+
−
** 856.133   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-9230]]
+
* '''1''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[RXN1F-461]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''3''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8290 RXN-8290]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8291 RXN-8291]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8289 RXN-8289]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-3803}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C17432 C17432]
+
{{#set: common name=kaempferol triglucoside biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60721 60721]
+
{{#set: reaction not found=3}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245574 25245574]
+
−
* HMDB : HMDB59616
+
−
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
−
{{#set: inchi key=InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K}}
+
−
{{#set: common name=all-trans-decaprenyl diphosphate}}
+
−
{{#set: molecular weight=856.133    }}
+
−
{{#set: consumed by=RXN-9230}}
+

Revision as of 11:05, 18 January 2018

Pathway PWY-5348

  • taxonomic range:
  • common name:
    • kaempferol triglucoside biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=1CMET2-PWY&oldid=6329"