Difference between revisions of "TRANS-RXN1HP7-12"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6620 PWY-6620] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C * i...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N |
* common name: | * common name: | ||
− | ** | + | ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol |
+ | * molecular weight: | ||
+ | ** 396.612 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** MGGBQ | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14917]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20737 C20737] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10470958.html 10470958] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75411 75411] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14759579 14759579] |
+ | {{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C}} | ||
+ | {{#set: inchi key=InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N}} | ||
+ | {{#set: common name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}} | ||
+ | {{#set: molecular weight=396.612 }} | ||
+ | {{#set: common name=MGGBQ}} | ||
+ | {{#set: consumed by=RXN-14917}} |
Revision as of 11:06, 18 January 2018
Contents
Metabolite CPD-11712
- smiles:
- CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C
- inchi key:
- InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N
- common name:
- 2-methyl-6-geranylgeranyl-1,4-benzoquinol
- molecular weight:
- 396.612
- Synonym(s):
- MGGBQ
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links