Difference between revisions of "RXN-16654"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6339 PWY-6339] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8617 CPD-8617] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8617 CPD-8617] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C |
| + | * inchi key: | ||
| + | ** InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 4α-hydroxymethyl-5α-cholesta-8-en-3β-ol |
| + | * molecular weight: | ||
| + | ** 416.686 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN66-21]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN66-20]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263322 44263322] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87053 87053] |
| + | * HMDB : HMDB12173 | ||
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C}} | ||
| + | {{#set: inchi key=InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N}} | ||
| + | {{#set: common name=4α-hydroxymethyl-5α-cholesta-8-en-3β-ol}} | ||
| + | {{#set: molecular weight=416.686 }} | ||
| + | {{#set: consumed by=RXN66-21}} | ||
| + | {{#set: produced by=RXN66-20}} | ||
Revision as of 11:09, 18 January 2018
Contents
Metabolite CPD-8617
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C
- inchi key:
- InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N
- common name:
- 4α-hydroxymethyl-5α-cholesta-8-en-3β-ol
- molecular weight:
- 416.686
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
