Difference between revisions of "CHC T00009226001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2]
+
** InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N
 +
* common name:
 +
** ent-kaurenal
 +
* molecular weight:
 +
** 286.456   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-kaur-16-en-19-al
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7580]]
−
** 1 [[Amino-Acids-20]][c] '''+''' 1 [[GLUTATHIONE]][c] '''=>''' 1 [[CYS-GLY]][c] '''+''' 1 [[5-L-GLUTAMYL-L-AMINO-ACID]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-5242]]
−
** 1 a proteinogenic amino acid[c] '''+''' 1 glutathione[c] '''=>''' 1 L-cysteinyl-glycine[c] '''+''' 1 an (γ-L-glutamyl)-L-amino acid[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00000071001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00005245001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-4041]], γ-glutamyl cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.2.2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443466 443466]
−
{{#set: gene associated=CHC_T00000071001_1|CHC_T00005245001_1}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-4041}}
+
** [http://www.chemspider.com/Chemical-Structure.391680.html 391680]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29609 29609]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11873 C11873]
 +
* HMDB : HMDB36728
 +
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))}}
 +
{{#set: inchi key=InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N}}
 +
{{#set: common name=ent-kaurenal}}
 +
{{#set: molecular weight=286.456    }}
 +
{{#set: common name=ent-kaur-16-en-19-al}}
 +
{{#set: consumed by=RXN-7580}}
 +
{{#set: produced by=RXN-5242}}

Revision as of 11:09, 18 January 2018

Metabolite ENT-KAUR-16-EN-19-AL

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))
  • inchi key:
    • InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N
  • common name:
    • ent-kaurenal
  • molecular weight:
    • 286.456
  • Synonym(s):
    • ent-kaur-16-en-19-al

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009226001_1&oldid=6696"