Difference between revisions of "CHC T00001019001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9000 CPD-9000] == * smiles: ** C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O * inchi key: ** InChI...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5515 RXN0-5515] == * direction: ** LEFT-TO-RIGHT * common name: ** Phosphatidate cytidylyltran...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9000 CPD-9000] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5515 RXN0-5515] ==
−
* smiles:
+
* direction:
−
** C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MKYPKZSGLSOGLL-LURJTMIESA-M
+
 
* common name:
 
* common name:
−
** 4-(γ-L-glutamylamino)butanoate
+
** Phosphatidate cytidylyltransferase
−
* molecular weight:
+
* ec number:
−
** 231.228   
+
** [http://enzyme.expasy.org/EC/2.7.7.41 EC-2.7.7.41]
 
* Synonym(s):
 
* Synonym(s):
−
** γ-glu-GABA
 
−
** γ-glutamyl-γ-aminobutyric acid
 
−
** γ-glutamyl-γ-aminobutyrate
 
−
** γ-glutamyl-γ-aminobutanoate
 
−
** 4-(glutamylamino)butanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-3942]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[2-3-4-Saturated-L-Phosphatidates]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CTP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CDP-2-3-4-Saturated-Diacylglycerols]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] '''+''' 1 H+[c] '''+''' 1 CTP[c] '''=>''' 1 diphosphate[c] '''+''' 1 a CDP-2,3,4-saturated-diacylglycerol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00010117001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00010117001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[CHC_T00009577001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00009577001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[CHC_T00001603001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15767 C15767]
+
{{#set: common name=Phosphatidate cytidylyltransferase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.7.7.41}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58800 58800]
+
{{#set: gene associated=CHC_T00010117001_1|CHC_T00010117001|CHC_T00009577001_1|CHC_T00009577001|CHC_T00001603001_1}}
−
* BIGG : gg4abut
+
{{#set: in pathway=}}
−
* PUBCHEM:
+
{{#set: reconstruction category=orthology}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245457 25245457]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB12161
+
{{#set: reconstruction source=galdieria.sulphuraria}}
−
{{#set: smiles=C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=MKYPKZSGLSOGLL-LURJTMIESA-M}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=4-(γ-L-glutamylamino)butanoate}}
+
{{#set: reconstruction source=original_genome}}
−
{{#set: molecular weight=231.228    }}
+
−
{{#set: common name=γ-glu-GABA|γ-glutamyl-γ-aminobutyric acid|γ-glutamyl-γ-aminobutyrate|γ-glutamyl-γ-aminobutanoate|4-(glutamylamino)butanoate}}
+
−
{{#set: consumed by=RXN0-3942}}
+

Revision as of 12:10, 18 January 2018

Reaction RXN0-5515

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Phosphatidate cytidylyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00001019001_1&oldid=6726"