Difference between revisions of "ACETONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9531 RXN-9531] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-dodecanoyl-[acyl-carrie...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9531 RXN-9531] ==
−
* smiles:
+
* direction:
−
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
+
 
* common name:
 
* common name:
−
** 5-dehydroavenasterol
+
** 3-oxo-dodecanoyl-[acyl-carrier protein] synthase
−
* molecular weight:
+
** Beta-ketoacyl synthase
−
** 410.682   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-4209]]
+
** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[Decanoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[3-oxo-dodecanoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 a decanoyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 a 3-oxo-dodecanoyl-[acp][c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00009465001_1]]
 +
** [[pantograph]]-[[a.taliana]]
 +
** [[pantograph]]-[[a.taliana]]
 +
* [[CHC_T00009465001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[a.taliana]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263331 44263331]
+
{{#set: common name=3-oxo-dodecanoyl-[acyl-carrier protein] synthase}}
−
* CHEBI:
+
{{#set: common name=Beta-ketoacyl synthase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097]
+
{{#set: ec number=EC-2.3.1.41}}
−
* LIGAND-CPD:
+
{{#set: gene associated=CHC_T00009465001_1|CHC_T00009465001}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783]
+
{{#set: in pathway=PWY-5971}}
−
* HMDB : HMDB06852
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}}
+
{{#set: reconstruction source=a.taliana}}
−
{{#set: common name=5-dehydroavenasterol}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=410.682    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: produced by=RXN-4209}}
+
{{#set: reconstruction source=original_genome}}

Revision as of 11:12, 18 January 2018

Reaction RXN-9531

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-dodecanoyl-[acyl-carrier protein] synthase
    • Beta-ketoacyl synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxo-dodecanoyl-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.






Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=ACETONE&oldid=6942"