Difference between revisions of "B-Keto-cis-D5-dodecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14196 RXN-14196] == * direction: ** LEFT-TO-RIGHT * common name: ** carbamoyl phosphate synthas...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14196 RXN-14196] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C(C(C(C(C1O)O)=O)O)O)O
 +
* inchi key:
 +
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
 
* common name:
 
* common name:
−
** carbamoyl phosphate synthase small subunit
+
** scyllo-inosose
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.2 EC-2.7.2]
+
** 178.141   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-keto-myo-inositol
 +
** 2,4,6/3,5-pentahydroxycyclohexanone
 +
** 2-inosose
 +
** 2-keto-scyllo-inositol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CARBAMATE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[CARBAMOYL-P]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
−
** 1 carbamate[c] '''+''' 1 ATP[c] '''=>''' 1 carbamoyl phosphate[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00010056001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00008596001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_70]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-7693]], guadinomine B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7693 PWY-7693]
+
−
** '''3''' reactions found over '''12''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30758 30758]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01395 R01395]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
−
{{#set: common name=carbamoyl phosphate synthase small subunit}}
+
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
−
{{#set: ec number=EC-2.7.2}}
+
{{#set: common name=scyllo-inosose}}
−
{{#set: gene associated=CHC_T00010056001_1|CHC_T00008596001_1|CHC_70}}
+
{{#set: molecular weight=178.141    }}
−
{{#set: in pathway=PWY-7693}}
+
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed or produced by=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=original_genome}}
+

Revision as of 11:12, 18 January 2018

Metabolite CPD-14808

  • smiles:
    • C1(C(C(C(C(C1O)O)=O)O)O)O
  • inchi key:
    • InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
  • common name:
    • scyllo-inosose
  • molecular weight:
    • 178.141
  • Synonym(s):
    • 2-keto-myo-inositol
    • 2,4,6/3,5-pentahydroxycyclohexanone
    • 2-inosose
    • 2-keto-scyllo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=B-Keto-cis-D5-dodecenoyl-ACPs&oldid=6946"