|
|
Line 1: |
Line 1: |
− | [[Category:Gene]] | + | [[Category:Metabolite]] |
− | == Gene CHC_T00009349001_1 == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == |
| + | * smiles: |
| + | ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5)))) |
| + | * inchi key: |
| + | ** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N |
| + | * common name: |
| + | ** cycloartenol |
| + | * molecular weight: |
| + | ** 426.724 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 9β,19-cyclo-24-lanosten-3β-ol |
| + | ** cycloart-24(25)-enol |
| | | |
− | == Reactions associated == | + | == Reaction(s) known to consume the compound == |
− | * [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]]
| + | == Reaction(s) known to produce the compound == |
− | ** [[pantograph]]-[[a.taliana]]
| + | * [[CYCLOARTENOL-SYNTHASE-RXN]] |
− | * [[5.1.2.3-RXN]]
| + | == Reaction(s) of unknown directionality == |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[ENOYL-COA-DELTA-ISOM-RXN]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[ENOYL-COA-HYDRAT-RXN]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[KETOACYLCOATHIOL-RXN]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[METHYLACYLYLCOA-HYDROXY-RXN]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[OHACYL-COA-DEHYDROG-RXN]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[OHBUTYRYL-COA-EPIM-RXN]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10697]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10698]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10699]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10700]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10701]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10702]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10703]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10704]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-10705]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-11244]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-11245]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-11246]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-11662]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[RXN-11667]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[RXN-12490]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[RXN-12507]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[RXN-12519]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-12565]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-12567]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-12570]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[RXN-12705]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-12710]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-12750]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-13616]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-13617]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14266]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14268]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14271]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[RXN-14272]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14273]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14274]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14277]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14394]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14774]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14788]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14793]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14799]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-14803]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-16133]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-16135]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-16137]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-16558]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17114]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17116]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17475]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17776]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17777]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17778]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17780]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17781]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17782]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17785]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17786]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17787]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17789]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17790]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17791]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17793]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17794]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17795]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17797]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17798]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-17799]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-2425]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[RXN-6383]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[RXN-7836]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-7931]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-902]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN-905]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN0-2044]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[RXN0-5393]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[TIGLYLCOA-HYDROXY-RXN]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | == Pathways associated == | + | |
− | * [[P162-PWY]]
| + | |
− | * [[PWY-5177]]
| + | |
− | * [[PWY-6583]]
| + | |
− | * [[VALDEG-PWY]]
| + | |
− | * [[PWY-6883]]
| + | |
− | * [[PWY-5138]]
| + | |
− | * [[PWY-5136]]
| + | |
− | * [[PWY-5137]]
| + | |
− | * [[PWY-7778]]
| + | |
− | * [[PWY-7779]]
| + | |
− | * [[PWY0-1337]]
| + | |
− | * [[PWY-7288]]
| + | |
− | * [[PWY-7340]]
| + | |
− | * [[ILEUDEG-PWY]]
| + | |
− | * [[PWY-7337]]
| + | |
− | * [[PWY-7574]]
| + | |
− | * [[PWY-7094]]
| + | |
− | * [[PWY-7654]]
| + | |
− | * [[P3-PWY]]
| + | |
− | * [[PWY66-391]]
| + | |
− | * [[PWY-5789]]
| + | |
− | * [[FAO-PWY]]
| + | |
− | * [[PWY-6837]]
| + | |
− | * [[PWY-7291]]
| + | |
− | * [[CENTFERM-PWY]]
| + | |
− | * [[PWY-6945]]
| + | |
− | * [[PWY0-321]]
| + | |
− | * [[PWY-7338]]
| + | |
− | * [[PWY-7339]]
| + | |
− | * [[PWY-5744]]
| + | |
− | * [[PWY-7007]]
| + | |
− | * [[PWY-5109]]
| + | |
− | * [[PWY-6948]]
| + | |
− | * [[PWY-7726]]
| + | |
− | * [[PWY-6435]]
| + | |
− | * [[PWY-7656]]
| + | |
− | * [[PWY-7046]]
| + | |
− | * [[PWY-7216]]
| + | |
− | * [[PWY-1361]]
| + | |
− | * [[PWY-7606]]
| + | |
− | * [[PWY-5743]]
| + | |
− | * [[PWY-6946]]
| + | |
− | * [[PWY-81]]
| + | |
− | * [[PWY-6944]]
| + | |
− | * [[PWY-735]]
| + | |
− | * [[PWY-7401]]
| + | |
− | * [[PWY-6863]]
| + | |
− | * [[PWY-3941]]
| + | |
| == External links == | | == External links == |
− | {{#set: reaction associated=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN|5.1.2.3-RXN|ENOYL-COA-DELTA-ISOM-RXN|ENOYL-COA-HYDRAT-RXN|KETOACYLCOATHIOL-RXN|METHYLACYLYLCOA-HYDROXY-RXN|OHACYL-COA-DEHYDROG-RXN|OHBUTYRYL-COA-EPIM-RXN|RXN-10697|RXN-10698|RXN-10699|RXN-10700|RXN-10701|RXN-10702|RXN-10703|RXN-10704|RXN-10705|RXN-11244|RXN-11245|RXN-11246|RXN-11662|RXN-11667|RXN-12490|RXN-12507|RXN-12519|RXN-12565|RXN-12567|RXN-12570|RXN-12705|RXN-12710|RXN-12750|RXN-13616|RXN-13617|RXN-14266|RXN-14268|RXN-14271|RXN-14272|RXN-14273|RXN-14274|RXN-14277|RXN-14394|RXN-14774|RXN-14788|RXN-14793|RXN-14799|RXN-14803|RXN-16133|RXN-16135|RXN-16137|RXN-16558|RXN-17114|RXN-17116|RXN-17475|RXN-17776|RXN-17777|RXN-17778|RXN-17780|RXN-17781|RXN-17782|RXN-17785|RXN-17786|RXN-17787|RXN-17789|RXN-17790|RXN-17791|RXN-17793|RXN-17794|RXN-17795|RXN-17797|RXN-17798|RXN-17799|RXN-2425|RXN-6383|RXN-7836|RXN-7931|RXN-902|RXN-905|RXN0-2044|RXN0-5393|TIGLYLCOA-HYDROXY-RXN}}
| + | * CAS : 469-38-5 |
− | {{#set: pathway associated=P162-PWY|PWY-5177|PWY-6583|VALDEG-PWY|PWY-6883|PWY-5138|PWY-5136|PWY-5137|PWY-7778|PWY-7779|PWY0-1337|PWY-7288|PWY-7340|ILEUDEG-PWY|PWY-7337|PWY-7574|PWY-7094|PWY-7654|P3-PWY|PWY66-391|PWY-5789|FAO-PWY|PWY-6837|PWY-7291|CENTFERM-PWY|PWY-6945|PWY0-321|PWY-7338|PWY-7339|PWY-5744|PWY-7007|PWY-5109|PWY-6948|PWY-7726|PWY-6435|PWY-7656|PWY-7046|PWY-7216|PWY-1361|PWY-7606|PWY-5743|PWY-6946|PWY-81|PWY-6944|PWY-735|PWY-7401|PWY-6863|PWY-3941}} | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254] |
| + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030] |
| + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902] |
| + | * HMDB : HMDB36591 |
| + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}} |
| + | {{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}} |
| + | {{#set: common name=cycloartenol}} |
| + | {{#set: molecular weight=426.724 }} |
| + | {{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}} |
| + | {{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}} |