Difference between revisions of "CPD1F-453"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Gene == Gene CHC_T00009034001_1 == * Synonym(s): == Reactions associated == * 2.4.1.119-RXN ** pantograph-galdieria.sulphuraria * RXN-16761 ** ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009034001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[2.4.1.119-RXN]] |
− | + | ** [[pantograph]]-[[galdieria.sulphuraria]] | |
− | * [[RXN- | + | * [[RXN-16761]] |
− | == | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | * [[ | + | == Pathways associated == |
+ | * [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.4.1.119-RXN|RXN-16761}} | |
− | + | {{#set: pathway associated=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 12:13, 18 January 2018
Gene CHC_T00009034001_1
- Synonym(s):