Difference between revisions of "PWY-3641"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6098 PWY-6098] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-13819 TAX-1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6098 PWY-6098] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=CC(=O)OC(=CC(=O)[O-])1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-13819 TAX-13819]
−
* inchi key:
+
−
** InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
+
 
* common name:
 
* common name:
−
** trans-dienelactone
+
** diploterol and cycloartenol biosynthesis
−
* molecular weight:
+
−
** 139.087   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-trans-dienelactone
+
** 22-hydroxyphopane-1 biosynthesis
−
** trans-4-carboxymethylenebut-2-en-1,4-olide
+
** cycloartenol biosynthesis
 +
** diploterol biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-9868]]
+
* '''1''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[CYCLOARTENOL-SYNTHASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''3''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=5.4.99.17-RXN 5.4.99.17-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE-MONOOXYGENASE-RXN SQUALENE-MONOOXYGENASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-4961 RXN-4961]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-13819}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543248 9543248]
+
{{#set: common name=diploterol and cycloartenol biosynthesis}}
−
* CHEMSPIDER:
+
{{#set: common name=22-hydroxyphopane-1 biosynthesis|cycloartenol biosynthesis|diploterol biosynthesis}}
−
** [http://www.chemspider.com/Chemical-Structure.7822189.html 7822189]
+
{{#set: reaction found=1}}
−
* LIGAND-CPD:
+
{{#set: reaction not found=3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12838 C12838]
+
−
{{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}}
+
−
{{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M}}
+
−
{{#set: common name=trans-dienelactone}}
+
−
{{#set: molecular weight=139.087    }}
+
−
{{#set: common name=2-trans-dienelactone|trans-4-carboxymethylenebut-2-en-1,4-olide}}
+
−
{{#set: consumed by=RXN-9868}}
+

Revision as of 12:15, 18 January 2018

Pathway PWY-6098

  • taxonomic range:
  • common name:
    • diploterol and cycloartenol biosynthesis
  • Synonym(s):
    • 22-hydroxyphopane-1 biosynthesis
    • cycloartenol biosynthesis
    • diploterol biosynthesis

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-3641&oldid=7157"