Difference between revisions of "PWY-7046"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Gene == Gene CHC_T00008298001 == * left end position: ** 156739 * transcription direction: ** NEGATIVE * right end position: ** 157926 * centisome position: ** 65...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] ==
+
== Gene CHC_T00008298001 ==
* smiles:
+
* left end position:
** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 156739
* inchi key:
+
* transcription direction:
** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
+
** NEGATIVE
* common name:
+
* right end position:
** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
+
** 157926
* molecular weight:
+
* centisome position:
** 1015.898    
+
** 65.449455    
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-16:1-Δ7-CoA
 
** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17781]]
+
* [[2.7.11.2-RXN]]
== Reaction(s) known to produce the compound ==
+
** original_genome
* [[RXN-17780]]
+
***automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=156739}}
{{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
{{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=157926}}
{{#set: molecular weight=1015.898   }}
+
{{#set: centisome position=65.449455   }}
{{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}}
+
{{#set: reaction associated=2.7.11.2-RXN}}
{{#set: consumed by=RXN-17781}}
+
{{#set: produced by=RXN-17780}}
+

Revision as of 12:15, 18 January 2018

Gene CHC_T00008298001

  • left end position:
    • 156739
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 157926
  • centisome position:
    • 65.449455
  • Synonym(s):

Reactions associated

Pathways associated

External links