Difference between revisions of "PWY-7187"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (R)-demethy...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5060 PWY-5060] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5060 PWY-5060] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
* common name: | * common name: | ||
| − | ** | + | ** luteolin biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | * '''1''' reaction(s) found |
| − | == Reaction(s) | + | ** [[RXN-7651]] |
| − | * [[RXN- | + | == Reaction(s) not found == |
| − | = | + | * '''5''' reaction(s) not found |
| − | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7650 RXN-7650] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7653 RXN-7653] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7652 RXN-7652] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7686 RXN-7686] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7687 RXN-7687] | ||
== External links == | == External links == | ||
| − | + | * ARACYC: | |
| − | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5060 PWY-5060] | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-3398}} |
| − | + | {{#set: common name=luteolin biosynthesis}} | |
| − | {{#set: common name= | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: reaction not found=5}} |
| − | {{#set: | + | |
| − | + | ||
Revision as of 12:19, 18 January 2018
Pathway PWY-5060
- taxonomic range:
- common name:
- luteolin biosynthesis
- Synonym(s):
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
External links
- ARACYC:
