Difference between revisions of "CHC 255"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myristoyl-ACPs Myristoyl-ACPs] == * common name: ** a myristoyl-[acp] * Synonym(s): ** a tetrad...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myristoyl-ACPs Myristoyl-ACPs] ==
* smiles:
+
** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
* inchi key:
+
** InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J
+
 
* common name:
 
* common name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA
+
** a myristoyl-[acp]
* molecular weight:
+
** 1039.92   
+
 
* Synonym(s):
 
* Synonym(s):
** oxopentenyl-cyclopentane-octanoyl-CoA
+
** a tetradecanoyl-[acyl-carrier protein]
** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA
+
** a tetradecanoyl-[acp]
** OPC-8:0-CoA
+
** a myristoyl-[acyl-carrier protein]
** OPC8-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10696]]
+
* [[RXN-17017]]
 +
* [[RXN-10727]]
 +
* [[RXN-9654]]
 +
* [[MYRISTOYLACYLTRAN-RXN]]
 +
* [[MYRPALMTRAN-RXN]]
 +
* [[RXN-9539]]
 +
* [[RXN-17022]]
 +
* [[RXN-17024]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9662]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN3O-8214]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a myristoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237325 44237325]
+
{{#set: common name=a tetradecanoyl-[acyl-carrier protein]|a tetradecanoyl-[acp]|a myristoyl-[acyl-carrier protein]}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: consumed by=RXN-17017|RXN-10727|RXN-9654|MYRISTOYLACYLTRAN-RXN|MYRPALMTRAN-RXN|RXN-9539|RXN-17022|RXN-17024}}
{{#set: inchi key=InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J}}
+
{{#set: produced by=RXN-9662}}
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA}}
+
{{#set: consumed or produced by=RXN3O-8214}}
{{#set: molecular weight=1039.92    }}
+
{{#set: common name=oxopentenyl-cyclopentane-octanoyl-CoA|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA|OPC-8:0-CoA|OPC8-CoA}}
+
{{#set: consumed by=RXN-10696}}
+

Revision as of 12:22, 18 January 2018

Metabolite Myristoyl-ACPs

  • common name:
    • a myristoyl-[acp]
  • Synonym(s):
    • a tetradecanoyl-[acyl-carrier protein]
    • a tetradecanoyl-[acp]
    • a myristoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a myristoyl-[acp" cannot be used as a page name in this wiki.
  • "a tetradecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "a tetradecanoyl-[acp" cannot be used as a page name in this wiki.
  • "a myristoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.