Difference between revisions of "CPD-2961"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10818 CPD-10818] == * smiles: ** C=C(CCOP(=O)([O-])[O-])C * common name: ** isopentenyl pho...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine Protein-L-methionine] == * common name: ** a [protein]-L-methionine * Syno...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10818 CPD-10818] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine Protein-L-methionine] ==
* smiles:
+
** C=C(CCOP(=O)([O-])[O-])C
+
 
* common name:
 
* common name:
** isopentenyl phosphate
+
** a [protein]-L-methionine
* inchi key:
+
** InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L
+
* molecular weight:
+
** 164.097   
+
 
* Synonym(s):
 
* Synonym(s):
** isopentenyl-P
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10067]]
+
* [[RXN-8668]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-10068]]
+
* [[1.8.4.12-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [protein]-L-methionine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123422 44123422]
+
{{#set: produced by=RXN-8668}}
* CHEBI:
+
{{#set: consumed or produced by=1.8.4.12-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65078 65078]
+
{{#set: smiles=C=C(CCOP(=O)([O-])[O-])C}}
+
{{#set: common name=isopentenyl phosphate}}
+
{{#set: inchi key=InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L}}
+
{{#set: molecular weight=164.097    }}
+
{{#set: common name=isopentenyl-P}}
+
{{#set: produced by=RXN-10067}}
+
{{#set: consumed or produced by=RXN-10068}}
+

Revision as of 11:22, 18 January 2018

Metabolite Protein-L-methionine

  • common name:
    • a [protein]-L-methionine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-L-methionine" cannot be used as a page name in this wiki.