Difference between revisions of "PWY-7385"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** L- | + | ** L-citrulline biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''6''' reaction(s) found |
− | * [[RXN- | + | ** [[GLUTKIN-RXN]] |
− | == Reaction(s) | + | ** [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] |
− | + | ** [[ARGINASE-RXN]] | |
+ | ** [[GLUTSEMIALDEHYDROG-RXN]] | ||
+ | ** [[ORNCARBAMTRANSFER-RXN]] | ||
+ | ** [[GLUTAMIN-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''2''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=SPONTPRO-RXN SPONTPRO-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-14903 RXN-14903] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-40674}} | |
− | + | {{#set: common name=L-citrulline biosynthesis}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: reaction not found=2}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name=L- | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 12:26, 18 January 2018
Pathway CITRULBIO-PWY
- taxonomic range:
- common name:
- L-citrulline biosynthesis
- Synonym(s):
Reaction(s) found
- 6 reaction(s) found
Reaction(s) not found
- 2 reaction(s) not found