Difference between revisions of "CHC T00009422001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * smiles: ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] * inchi key: ** InChIKey=KRKNYBC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10472 CPD-10472] == * smiles: ** C[S+](C)CCC=O * inchi key: ** InChIKey=OISJAAYQHIBAQP-UHFF...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10472 CPD-10472] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C[S+](C)CCC=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OISJAAYQHIBAQP-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** 3-dimethylsulfoniopropionaldehyde |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 119.201 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** DMSP-aldehyde |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9758]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=19824238 19824238] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74027 74027] |
− | * | + | * METABOLIGHTS : MTBLC74027 |
− | {{#set: smiles=C | + | {{#set: smiles=C[S+](C)CCC=O}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=OISJAAYQHIBAQP-UHFFFAOYSA-N}} |
− | {{#set: common name= | + | {{#set: common name=3-dimethylsulfoniopropionaldehyde}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=119.201 }} |
− | {{#set: common name= | + | {{#set: common name=DMSP-aldehyde}} |
− | {{#set: consumed by= | + | {{#set: consumed by=RXN-9758}} |
− | + | ||
− | + |
Revision as of 12:26, 18 January 2018
Contents
Metabolite CPD-10472
- smiles:
- C[S+](C)CCC=O
- inchi key:
- InChIKey=OISJAAYQHIBAQP-UHFFFAOYSA-N
- common name:
- 3-dimethylsulfoniopropionaldehyde
- molecular weight:
- 119.201
- Synonym(s):
- DMSP-aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[S+](C)CCC=O" cannot be used as a page name in this wiki.