Difference between revisions of "CHC T00001494001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-uridine-2552 23S-rRNA-uridine-2552] == * common name: ** uridine2552 in 23S rRNA * Syn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (S)-demethy...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] == |
| + | * smiles: | ||
| + | ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-demethyl-4-deoxygadusol |
| + | * inchi key: | ||
| + | ** InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N | ||
| + | * molecular weight: | ||
| + | ** 174.153 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17896]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-17895]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | {{#set: smiles=C(O)C1(O)(CC(=O)C(O)=C(O)C1)}} |
| − | {{#set: consumed by=RXN- | + | {{#set: common name=(S)-demethyl-4-deoxygadusol}} |
| + | {{#set: inchi key=InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N}} | ||
| + | {{#set: molecular weight=174.153 }} | ||
| + | {{#set: common name=(5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one}} | ||
| + | {{#set: consumed by=RXN-17896}} | ||
| + | {{#set: consumed or produced by=RXN-17895}} | ||
Revision as of 12:26, 18 January 2018
Contents
Metabolite CPD-19220
- smiles:
- C(O)C1(O)(CC(=O)C(O)=C(O)C1)
- common name:
- (S)-demethyl-4-deoxygadusol
- inchi key:
- InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N
- molecular weight:
- 174.153
- Synonym(s):
- (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one
