Difference between revisions of "RXN66-28"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** flavin biosynthesis III (fungi) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''6''' reaction(s) found |
− | * [[ | + | ** [[RIBOFLAVIN-SYN-RXN]] |
− | * [[ | + | ** [[LUMAZINESYN-RXN]] |
− | * [[ | + | ** [[RIBOFLAVINKIN-RXN]] |
− | * [[ | + | ** [[FADSYN-RXN]] |
− | == Reaction(s) | + | ** [[DIOHBUTANONEPSYN-RXN]] |
− | * | + | ** [[GTP-CYCLOHYDRO-II-RXN]] |
− | * | + | == Reaction(s) not found == |
− | * [ | + | * '''3''' reaction(s) not found |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10058 RXN-10058] | |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RIBOPHOSPHAT-RXN RIBOPHOSPHAT-RXN] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10057 RXN-10057] | |
− | * [ | + | |
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=flavin biosynthesis III (fungi)}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: reaction not found=3}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 11:28, 18 January 2018
Pathway PWY-6168
- taxonomic range:
- common name:
- flavin biosynthesis III (fungi)
- Synonym(s):
Reaction(s) found
- 6 reaction(s) found
Reaction(s) not found
- 3 reaction(s) not found