Difference between revisions of "CHC T00009281001"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009230001_1 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] == * smiles: ** C(=CC(=O)[O-])C(=O)CC([O-])=O * inchi key: ** InChIKey=SOXXPQL...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] == |
+ | * smiles: | ||
+ | ** C(=CC(=O)[O-])C(=O)CC([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L | ||
+ | * common name: | ||
+ | ** 2-maleylacetate | ||
+ | * molecular weight: | ||
+ | ** 156.095 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-oxohex-2-enedioate | ||
+ | ** maleylacetate | ||
+ | ** (2Z)-4-oxohex-2-enedioate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-9868]] | |
− | == | + | * [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543165 9543165] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.7822138.html 7822138] | ||
+ | * UM-BBD-CPD : c0099 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16468 16468] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02222 C02222] | ||
+ | {{#set: smiles=C(=CC(=O)[O-])C(=O)CC([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L}} | ||
+ | {{#set: common name=2-maleylacetate}} | ||
+ | {{#set: molecular weight=156.095 }} | ||
+ | {{#set: common name=4-oxohex-2-enedioate|maleylacetate|(2Z)-4-oxohex-2-enedioate}} | ||
+ | {{#set: produced by=RXN-9868|CARBOXYMETHYLENEBUTENOLIDASE-RXN}} |
Revision as of 12:28, 18 January 2018
Contents
Metabolite CPD-294
- smiles:
- C(=CC(=O)[O-])C(=O)CC([O-])=O
- inchi key:
- InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L
- common name:
- 2-maleylacetate
- molecular weight:
- 156.095
- Synonym(s):
- 4-oxohex-2-enedioate
- maleylacetate
- (2Z)-4-oxohex-2-enedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(=O)CC([O-])=O" cannot be used as a page name in this wiki.