Difference between revisions of "PWY-5895"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00002917001_1 == * Synonym(s): == Reactions associated == * 2-DEHYDROPANTOATE-REDUCT-RXN ** pantograph-galdieria.sulphuraria == Pat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == * smiles: ** C(OP(=O)([O-])...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2)) | ||
| + | * inchi key: | ||
| + | ** InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K | ||
| + | * common name: | ||
| + | ** N-(5-phosphoribosyl)-anthranilate | ||
| + | * molecular weight: | ||
| + | ** 346.21 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** N-(5-phospho-D-ribosyl)-anthranilate | ||
| + | ** N-(5-phospho-β-D-ribosyl)-anthranilate | ||
| + | ** 5-phosphoribosyl-anthranilate | ||
| + | ** 5-P-ribosyl-anthranilate | ||
| + | ** 5'-phosphoribosyl-anthranilate | ||
| + | ** 5'-P-ribosyl-anthranilate | ||
| + | ** N-(5-phosphoribosyl)-anthranilate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[PRAISOM-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | * [[PRTRANS-RXN]] |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548600 9548600] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18277 18277] | ||
| + | * BIGG : pran | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04302 C04302] | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))}} | ||
| + | {{#set: inchi key=InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K}} | ||
| + | {{#set: common name=N-(5-phosphoribosyl)-anthranilate}} | ||
| + | {{#set: molecular weight=346.21 }} | ||
| + | {{#set: common name=N-(5-phospho-D-ribosyl)-anthranilate|N-(5-phospho-β-D-ribosyl)-anthranilate|5-phosphoribosyl-anthranilate|5-P-ribosyl-anthranilate|5'-phosphoribosyl-anthranilate|5'-P-ribosyl-anthranilate|N-(5-phosphoribosyl)-anthranilate}} | ||
| + | {{#set: consumed by=PRAISOM-RXN}} | ||
| + | {{#set: consumed or produced by=PRTRANS-RXN}} | ||
Revision as of 11:30, 18 January 2018
Contents
Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE
- smiles:
- C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))
- inchi key:
- InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K
- common name:
- N-(5-phosphoribosyl)-anthranilate
- molecular weight:
- 346.21
- Synonym(s):
- N-(5-phospho-D-ribosyl)-anthranilate
- N-(5-phospho-β-D-ribosyl)-anthranilate
- 5-phosphoribosyl-anthranilate
- 5-P-ribosyl-anthranilate
- 5'-phosphoribosyl-anthranilate
- 5'-P-ribosyl-anthranilate
- N-(5-phosphoribosyl)-anthranilate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))" cannot be used as a page name in this wiki.
