Difference between revisions of "GARTRANSFORMYL2-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9220 RXN-9220] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9220 RXN-9220] ==
* smiles:
+
* direction:
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
+
** [http://enzyme.expasy.org/EC/2.1.1.163 EC-2.1.1.163]
* common name:
+
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
+
* molecular weight:
+
** 427.646   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-318]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-12116]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-12124]][c]
* [[RXN-13709]]
+
* With common name(s):
* [[RXN66-317]]
+
** 1 demethylmenaquinol-6[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 menaquinol-6[c]
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00001339001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00000517001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00005416001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00000214001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-5849]], menaquinol-6 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5849 PWY-5849]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
+
{{#set: ec number=EC-2.1.1.163}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: gene associated=CHC_T00001339001_1|CHC_T00000517001_1|CHC_T00005416001_1|CHC_T00000214001_1}}
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
+
{{#set: in pathway=PWY-5849}}
{{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=427.646    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: consumed by=RXN66-318}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
{{#set: produced by=RXN-13709|RXN66-317}}
+

Revision as of 11:31, 18 January 2018

Reaction RXN-9220

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5849, menaquinol-6 biosynthesis: PWY-5849
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links