Difference between revisions of "IDNCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-1346 CPD1G-1346] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCCCCC(C(OCC1(OC(C(C(C1O)O)O)OC2(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=CBIDRCWHNCKSTO-UHFFFAOYSA-K |
* common name: | * common name: | ||
| − | ** | + | ** dimethylallyl diphosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 243.069 |
* Synonym(s): | * Synonym(s): | ||
| + | ** dimethylallyl-diphosphate | ||
| + | ** prenyl-diphosphate | ||
| + | ** δ-prenyl diphosphate | ||
| + | ** δ2-isopentenyl-diphosphate | ||
| + | ** 2-isopentenyl diphosphate | ||
| + | ** prenyl diphosphate | ||
| + | ** DMAPP | ||
| + | ** DPP | ||
| + | ** di-CH3-allyl-PPi | ||
| + | ** dimethylallyl-PP | ||
| + | ** dimethylallyl-PPi | ||
| + | ** DMPP | ||
| + | ** dimethylallyl pyrophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-884]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[IPPISOM-RXN]] | ||
| + | * [[GPPSYN-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 358-71-4 | ||
| + | * METABOLIGHTS : MTBLC57623 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15983958 15983958] |
| − | {{#set: smiles= | + | * HMDB : HMDB01120 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00235 C00235] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: produced by= | + | ** [http://www.chemspider.com/Chemical-Structure.13115336.html 13115336] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57623 57623] | ||
| + | * BIGG : dmpp | ||
| + | {{#set: smiles=CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=CBIDRCWHNCKSTO-UHFFFAOYSA-K}} | ||
| + | {{#set: common name=dimethylallyl diphosphate}} | ||
| + | {{#set: molecular weight=243.069 }} | ||
| + | {{#set: common name=dimethylallyl-diphosphate|prenyl-diphosphate|δ-prenyl diphosphate|δ2-isopentenyl-diphosphate|2-isopentenyl diphosphate|prenyl diphosphate|DMAPP|DPP|di-CH3-allyl-PPi|dimethylallyl-PP|dimethylallyl-PPi|DMPP|dimethylallyl pyrophosphate}} | ||
| + | {{#set: produced by=RXN0-884}} | ||
| + | {{#set: consumed or produced by=IPPISOM-RXN|GPPSYN-RXN}} | ||
Revision as of 11:33, 18 January 2018
Contents
Metabolite CPD-4211
- smiles:
- CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
- inchi key:
- InChIKey=CBIDRCWHNCKSTO-UHFFFAOYSA-K
- common name:
- dimethylallyl diphosphate
- molecular weight:
- 243.069
- Synonym(s):
- dimethylallyl-diphosphate
- prenyl-diphosphate
- δ-prenyl diphosphate
- δ2-isopentenyl-diphosphate
- 2-isopentenyl diphosphate
- prenyl diphosphate
- DMAPP
- DPP
- di-CH3-allyl-PPi
- dimethylallyl-PP
- dimethylallyl-PPi
- DMPP
- dimethylallyl pyrophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 358-71-4
- METABOLIGHTS : MTBLC57623
- PUBCHEM:
- HMDB : HMDB01120
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : dmpp
"CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-" cannot be used as a page name in this wiki.
