Difference between revisions of "RXN66-27"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
 
(Created page with "Category:Gene == Gene CHC_T00010236001 == * left end position: ** 83398 * transcription direction: ** NEGATIVE * right end position: ** 84498 * centisome position: ** 15.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
+
== Gene CHC_T00010236001 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
+
** 83398
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5α-cholesta-8-en-3-one
+
** 84498
−
* molecular weight:
+
* centisome position:
−
** 384.644    
+
** 15.942879    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-11109]]
−
* [[RXN66-23]]
+
** original_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=83398}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263324 44263324]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=84498}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87056 87056]
+
{{#set: centisome position=15.942879   }}
−
* HMDB : HMDB12178
+
{{#set: reaction associated=RXN-11109}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
+
−
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
+
−
{{#set: common name=5α-cholesta-8-en-3-one}}
+
−
{{#set: molecular weight=384.644   }}
+
−
{{#set: produced by=RXN66-23}}
+

Revision as of 11:34, 18 January 2018

Gene CHC_T00010236001

  • left end position:
    • 83398
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 84498
  • centisome position:
    • 15.942879
  • Synonym(s):

Reactions associated

  • RXN-11109
    • original_genome
      • automated-name-match

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN66-27&oldid=8704"