Difference between revisions of "RXN-5463"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6383 RXN-6383] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/4.2.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6383 RXN-6383] ==
−
* smiles:
+
* direction:
−
** C(O)C1(OC(O)C(O)C(O)C(O)1)
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N
+
** [http://enzyme.expasy.org/EC/4.2.1.116 EC-4.2.1.116]
−
* common name:
+
−
** β-D-galactose
+
−
* molecular weight:
+
−
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-galactopyranose
 
−
** cerebrose
 
−
** 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[BETAGALACTOSID-RXN]]
+
** 1 [[3-HYDROXY-PROPIONYL-COA]][c] '''<=>''' 1 [[ACRYLYL-COA]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[ALDOSE1EPIM-RXN]]
+
** 1 3-hydroxypropanoyl-CoA[c] '''<=>''' 1 acryloyl-CoA[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00009110001_1]]
 +
** [[pantograph]]-[[a.taliana]]
 +
* [[CHC_T00008882001_1]]
 +
** [[pantograph]]-[[a.taliana]]
 +
* [[CHC_T00009349001_1]]
 +
** [[pantograph]]-[[a.taliana]]
 +
== Pathways  ==
 +
* [[PWY-7574]], propanoyl-CoA degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7574 PWY-7574]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-3941]], &beta;-alanine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3941 PWY-3941]
 +
** '''2''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-5743]], 3-hydroxypropanoate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743]
 +
** '''2''' reactions found over '''11''' reactions in the full pathway
 +
* [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
 +
** '''5''' reactions found over '''16''' reactions in the full pathway
 +
* [[PWY-5744]], glyoxylate assimilation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5744 PWY-5744]
 +
** '''2''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[a.taliana]]
 
== External links  ==
 
== External links  ==
−
* CAS : 7296-64-2
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26518 26518]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439353 439353]
+
* LIGAND-RXN:
−
* HMDB : HMDB03449
+
** [http://www.genome.jp/dbget-bin/www_bget?R03045 R03045]
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00962 C00962]
+
{{#set: ec number=EC-4.2.1.116}}
−
* CHEMSPIDER:
+
{{#set: gene associated=CHC_T00009110001_1|CHC_T00008882001_1|CHC_T00009349001_1}}
−
** [http://www.chemspider.com/Chemical-Structure.388476.html 388476]
+
{{#set: in pathway=PWY-7574|PWY-3941|PWY-5743|PWY-5789|PWY-5744}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28034 28034]
+
{{#set: reconstruction tool=pantograph}}
−
* BIGG : gal
+
{{#set: reconstruction source=a.taliana}}
−
* BIGG : gal-bD
+
−
{{#set: smiles=C(O)C1(OC(O)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N}}
+
−
{{#set: common name=&beta;-D-galactose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: common name=&beta;-D-galactopyranose|cerebrose|6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol}}
+
−
{{#set: produced by=BETAGALACTOSID-RXN}}
+
−
{{#set: consumed or produced by=ALDOSE1EPIM-RXN}}
+

Revision as of 11:34, 18 January 2018

Reaction RXN-6383

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7574, propanoyl-CoA degradation II: PWY-7574
    • 2 reactions found over 5 reactions in the full pathway
  • PWY-3941, β-alanine biosynthesis II: PWY-3941
    • 2 reactions found over 6 reactions in the full pathway
  • PWY-5743, 3-hydroxypropanoate cycle: PWY-5743
    • 2 reactions found over 11 reactions in the full pathway
  • PWY-5789, 3-hydroxypropanoate/4-hydroxybutanate cycle: PWY-5789
    • 5 reactions found over 16 reactions in the full pathway
  • PWY-5744, glyoxylate assimilation: PWY-5744
    • 2 reactions found over 11 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-5463&oldid=8736"