Difference between revisions of "PWY-7571"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7571 PWY-7571] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
** chlorophyllide b
+
** ferrichrome A biosynthesis
* molecular weight:
+
* taxonomic range:
** 626.95   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-7674]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[RXN-7673]]
+
*** [[CHC_T00008149001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLGLUTACONYL-COA-HYDRATASE-RXN METHYLGLUTACONYL-COA-HYDRATASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11128 RXN-11128]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15950 RXN-15950]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15951 RXN-15951]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=ferrichrome A biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741]
+
{{#set: taxonomic range=TAX-4751}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686]
+
{{#set: total reaction=5}}
* LIGAND-CPD:
+
{{#set: completion rate=20.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyllide b}}
+
{{#set: molecular weight=626.95    }}
+
{{#set: consumed by=RXN-7674}}
+
{{#set: consumed or produced by=RXN-7673}}
+

Latest revision as of 15:22, 9 January 2019

Pathway PWY-7571

  • common name:
    • ferrichrome A biosynthesis
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links