Difference between revisions of "CPD-16618"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008626001_1 == * Synonym(s): == Reactions associated == * 5.3.4.1-RXN ** pantograph-galdieria.sulphuraria * DISULISOM-RXN **...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008626001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
 +
* smiles:
 +
** C(C(=O)[O-])C(O)[CH]=O
 +
* molecular weight:
 +
** 117.081   
 +
* inchi key:
 +
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
 +
* common name:
 +
** L-malic semialdehyde
 
* Synonym(s):
 
* Synonym(s):
 +
** (3R)-3-hydroxy-4-oxobutanoate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[5.3.4.1-RXN]]
+
* [[RXN-6002]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
* [[DISULISOM-RXN]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=5.3.4.1-RXN|DISULISOM-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
 +
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
 +
{{#set: molecular weight=117.081    }}
 +
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
 +
{{#set: common name=L-malic semialdehyde}}
 +
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
 +
{{#set: consumed by=RXN-6002}}

Latest revision as of 17:36, 9 January 2019

Metabolite CPD-16618

  • smiles:
    • C(C(=O)[O-])C(O)[CH]=O
  • molecular weight:
    • 117.081
  • inchi key:
    • InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
  • common name:
    • L-malic semialdehyde
  • Synonym(s):
    • (3R)-3-hydroxy-4-oxobutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.