Difference between revisions of "FERULOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxy-cis-D7-tetraecenoyl-ACPs 3-hydroxy-cis-D7-tetraecenoyl-ACPs] == * common name: ** a (...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULOYL-COA FERULOYL-COA] == |
| + | * smiles: | ||
| + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] | ||
| + | * molecular weight: | ||
| + | ** 939.674 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GBXZVJQQDAJGSO-NBXNMEGSSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** feruloyl-CoA |
* Synonym(s): | * Synonym(s): | ||
| + | ** trans-feruloyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-1106]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[6.2.1.34-RXN]] |
| + | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: consumed by=RXN- | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57276 57276] |
| − | {{#set: produced by=RXN- | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229137 44229137] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00406 C00406] | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: molecular weight=939.674 }} | ||
| + | {{#set: inchi key=InChIKey=GBXZVJQQDAJGSO-NBXNMEGSSA-J}} | ||
| + | {{#set: common name=feruloyl-CoA}} | ||
| + | {{#set: common name=trans-feruloyl-CoA}} | ||
| + | {{#set: consumed by=RXN-1106}} | ||
| + | {{#set: produced by=6.2.1.34-RXN|CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN}} | ||
Latest revision as of 17:36, 9 January 2019
Contents
Metabolite FERULOYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- molecular weight:
- 939.674
- inchi key:
- InChIKey=GBXZVJQQDAJGSO-NBXNMEGSSA-J
- common name:
- feruloyl-CoA
- Synonym(s):
- trans-feruloyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
