Difference between revisions of "RXN-13444"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13444 RXN-13444] ==
−
* smiles:
+
* direction:
−
** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M
+
** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134]
−
* common name:
+
−
** biotin
+
−
* molecular weight:
+
−
** 243.3   
+
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin H
 
−
** coenzyme R
 
−
** d-biotin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[TransportSeed_BIOTIN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-14424]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-14425]][c]
−
* [[TransportSeed_BIOTIN]]
+
* With common name(s):
−
* [[2.8.1.6-RXN]]
+
** 1 (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosapentaenoyl-CoA[c] '''=>''' 1 H2O[c] '''+''' 1 (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA[c]
−
* [[RXN-17473]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[ExchangeSeed_BIOTIN]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008580001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606]
 +
** '''7''' reactions found over '''14''' reactions in the full pathway
 +
* [[PWY-7053]], docosahexaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7053 PWY-7053]
 +
** '''4''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7727]], docosahexaenoate biosynthesis IV (4-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7727 PWY-7727]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 58-85-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC57586
+
{{#set: ec number=EC-4.2.1.134}}
−
* PUBCHEM:
+
{{#set: gene associated=CHC_T00008580001_1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560210 6560210]
+
{{#set: in pathway=PWY-7606|PWY-7053|PWY-7727}}
−
* HMDB : HMDB00030
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00120 C00120]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5028036.html 5028036]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57586 57586]
+
−
* BIGG : btn
+
−
{{#set: smiles=C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))}}
+
−
{{#set: inchi key=InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M}}
+
−
{{#set: common name=biotin}}
+
−
{{#set: molecular weight=243.3    }}
+
−
{{#set: common name=vitamin H|coenzyme R|d-biotin}}
+
−
{{#set: consumed by=TransportSeed_BIOTIN}}
+
−
{{#set: produced by=TransportSeed_BIOTIN|2.8.1.6-RXN|RXN-17473}}
+
−
{{#set: consumed or produced by=ExchangeSeed_BIOTIN}}
+

Latest revision as of 17:35, 9 January 2019

Reaction RXN-13444

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosapentaenoyl-CoA[c] => 1 H2O[c] + 1 (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7606, docosahexaenoate biosynthesis III (6-desaturase, mammals): PWY-7606
    • 7 reactions found over 14 reactions in the full pathway
  • PWY-7053, docosahexaenoate biosynthesis I (lower eukaryotes): PWY-7053
    • 4 reactions found over 7 reactions in the full pathway
  • PWY-7727, docosahexaenoate biosynthesis IV (4-desaturase, mammals): PWY-7727
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-13444&oldid=23260"