Difference between revisions of "6-Phosphogluco-Maltodextrins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6-Phosphogluco-Maltodextrins 6-Phosphogluco-Maltodextrins] == * common name: ** a 6-phosphogluc...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6-Phosphogluco-Maltodextrins 6-Phosphogluco-Maltodextrins] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 6-phosphogluco-maltodextrin |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** ( | + | ** [Gln](n)Glc6-P |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-12201]] |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 6-phosphogluco-maltodextrin}} | |
| − | + | {{#set: common name=[Gln](n)Glc6-P}} | |
| − | + | {{#set: reversible reaction associated=RXN-12201}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name=( | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 16:42, 23 May 2018
Contents
Metabolite 6-Phosphogluco-Maltodextrins
- common name:
- a 6-phosphogluco-maltodextrin
- Synonym(s):
- [Gln](n)Glc6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"Gln](n)Glc6-P" cannot be used as a page name in this wiki.
