Difference between revisions of "3-P-SERINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMALDEHYDE FORMALDEHYDE] == * smiles: ** [CH2]=O * inchi key: ** InChIKey=WSFSSNUMVMOOMR-UHFF...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == |
* smiles: | * smiles: | ||
− | ** [ | + | ** C(OP([O-])([O-])=O)C([N+])C([O-])=O |
+ | * molecular weight: | ||
+ | ** 183.057 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L |
* common name: | * common name: | ||
− | ** | + | ** 3-phospho-L-serine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** O-phospho-L-serine |
− | ** | + | ** L-serine phosphate |
− | ** | + | ** phosphoryl-L-serine |
+ | ** L-seryl phosphate | ||
+ | ** L-serine-3P | ||
+ | ** L-serine 3-phosphate | ||
+ | ** 3-phospho-L-serine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-5114]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[PSERTRANSAM-RXN]] |
== External links == | == External links == | ||
− | * CAS : | + | * BIGG : pser__L |
− | * | + | * CAS : 407-41-0 |
− | + | * CAS : 17885-08-4 | |
− | + | * HMDB : HMDB00272 | |
− | + | ||
− | * HMDB : | + | |
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.5415612.html 5415612] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57524 57524] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=[ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01005 C01005] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059387 7059387] |
− | {{#set: | + | {{#set: smiles=C(OP([O-])([O-])=O)C([N+])C([O-])=O}} |
− | {{#set: common name= | + | {{#set: molecular weight=183.057 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L}} |
− | {{#set: | + | {{#set: common name=3-phospho-L-serine}} |
+ | {{#set: common name=O-phospho-L-serine|L-serine phosphate|phosphoryl-L-serine|L-seryl phosphate|L-serine-3P|L-serine 3-phosphate|3-phospho-L-serine}} | ||
+ | {{#set: consumed by=RXN0-5114}} | ||
+ | {{#set: reversible reaction associated=PSERTRANSAM-RXN}} |
Latest revision as of 17:38, 9 January 2019
Contents
Metabolite 3-P-SERINE
- smiles:
- C(OP([O-])([O-])=O)C([N+])C([O-])=O
- molecular weight:
- 183.057
- inchi key:
- InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L
- common name:
- 3-phospho-L-serine
- Synonym(s):
- O-phospho-L-serine
- L-serine phosphate
- phosphoryl-L-serine
- L-seryl phosphate
- L-serine-3P
- L-serine 3-phosphate
- 3-phospho-L-serine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : pser__L
- CAS : 407-41-0
- CAS : 17885-08-4
- HMDB : HMDB00272
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(OP([O-])([O-])=O)C([N+])C([O-])=O" cannot be used as a page name in this wiki.