Difference between revisions of "CPD-19144"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10973 RXN-10973] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10973 RXN-10973] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.7.4.24 EC-2.7.4.24]
+
** 999.899   
 +
* inchi key:
 +
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
 +
* common name:
 +
** (7Z)-hexadecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** cis-hexadec-7-enoyl-CoA
 +
** (7Z)-hexadec-7-enoyl-CoA
 +
** 16:1 cis-7
 +
** 16:1(n-9)
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17779]]
** 1 [[ATP]][c] '''+''' 1 [[CPD-11937]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-11939]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17778]]
** 1 ATP[c] '''+''' 1 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate[c] '''=>''' 1 ADP[c] '''+''' 1 3,5-bisdiphosphoinositol-1D-myo-inositol 2,3,4,6-tetrakisphosphate[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00003487001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-6369]], inositol pyrophosphates biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369]
+
** '''5''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: ec number=EC-2.7.4.24}}
+
{{#set: molecular weight=999.899    }}
{{#set: gene associated=CHC_T00003487001_1}}
+
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
{{#set: in pathway=PWY-6369}}
+
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-17779}}
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: produced by=RXN-17778}}

Latest revision as of 17:39, 9 January 2019

Metabolite CPD-19144

  • smiles:
    • CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 999.899
  • inchi key:
    • InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
  • common name:
    • (7Z)-hexadecenoyl-CoA
  • Synonym(s):
    • cis-hexadec-7-enoyl-CoA
    • (7Z)-hexadec-7-enoyl-CoA
    • 16:1 cis-7
    • 16:1(n-9)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.