Difference between revisions of "OCTAPRENYL-DIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Saturated-Fatty-Acyl-CoA 3-Methyl-Saturated-Fatty-Acyl-CoA] == * common name: ** a 3-m...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-DIPHOSPHATE OCTAPRENYL-DIPHOSPHATE] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] | ||
+ | * molecular weight: | ||
+ | ** 719.897 | ||
+ | * inchi key: | ||
+ | ** InChIKey=IKKLDISSULFFQO-DJMILUHSSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** all-trans-octaprenyl diphosphate |
* Synonym(s): | * Synonym(s): | ||
+ | ** farnesylfarnesylgeranyl-PP | ||
+ | ** octaprenyl pyrophosphate | ||
+ | ** OPP | ||
+ | ** farnesylfarnesylgeraniol | ||
+ | ** octaprenyl diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57711 57711] |
+ | * BIGG : octdp | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245331 25245331] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04146 C04146] | ||
+ | * HMDB : HMDB01094 | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}} | ||
+ | {{#set: molecular weight=719.897 }} | ||
+ | {{#set: inchi key=InChIKey=IKKLDISSULFFQO-DJMILUHSSA-K}} | ||
+ | {{#set: common name=all-trans-octaprenyl diphosphate}} | ||
+ | {{#set: common name=farnesylfarnesylgeranyl-PP|octaprenyl pyrophosphate|OPP|farnesylfarnesylgeraniol|octaprenyl diphosphate}} | ||
+ | {{#set: consumed by=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN}} |
Latest revision as of 17:40, 9 January 2019
Contents
Metabolite OCTAPRENYL-DIPHOSPHATE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
- molecular weight:
- 719.897
- inchi key:
- InChIKey=IKKLDISSULFFQO-DJMILUHSSA-K
- common name:
- all-trans-octaprenyl diphosphate
- Synonym(s):
- farnesylfarnesylgeranyl-PP
- octaprenyl pyrophosphate
- OPP
- farnesylfarnesylgeraniol
- octaprenyl diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-" cannot be used as a page name in this wiki.