Difference between revisions of "CYSPH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSPH-RXN CYSPH-RXN] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
+
** [http://enzyme.expasy.org/EC/2.5.1 EC-2.5.1]
* common name:
+
** 6-cis-tridecenoyl-CoA
+
* molecular weight:
+
** 957.819   
+
 
* Synonym(s):
 
* Synonym(s):
** 6Z-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14771]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CYS]][c] '''+''' 1 [[O-PHOSPHO-L-HOMOSERINE]][c] '''=>''' 1 [[L-CYSTATHIONINE]][c] '''+''' 1 [[Pi]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-cysteine[c] '''+''' 1 O-phospho-L-homoserine[c] '''=>''' 1 L-cystathionine[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
 +
** '''4''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
+
{{#set: ec number=EC-2.5.1}}
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-702}}
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
+
{{#set: reconstruction category=gap-filling}}
{{#set: common name=6-cis-tridecenoyl-CoA}}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
{{#set: molecular weight=957.819    }}
+
{{#set: reconstruction tool=meneco}}
{{#set: common name=6Z-tridecenoyl-CoA}}
+
{{#set: reconstruction comment=added for gapfilling}}
{{#set: consumed by=RXN-14771}}
+

Latest revision as of 17:38, 9 January 2019

Reaction CYSPH-RXN

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-702, L-methionine biosynthesis II: PWY-702
    • 4 reactions found over 8 reactions in the full pathway

Reconstruction information

External links