Difference between revisions of "HISTALDEHYD-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HISTALDEHYD-RXN HISTALDEHYD-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** histidinol dehydrogenase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[HISTIDINAL]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[HIS]][c] '''+''' 1 [[NADH]][c] | |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 histidinal[c] '''=>''' 2 H+[c] '''+''' 1 L-histidine[c] '''+''' 1 NADH[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[CHC_T00008451001_1]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | * Gene: [[CHC_T00008451001]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[HISTSYN-PWY]], L-histidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HISTSYN-PWY HISTSYN-PWY] |
− | * [[ | + | ** '''10''' reactions found over '''10''' reactions in the full pathway |
− | + | == Reconstruction information == | |
− | * [[ | + | * Category: [[orthology]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33803 33803] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P24226 P24226] |
− | * | + | ** [http://www.uniprot.org/uniprot/P44001 P44001] |
− | * | + | ** [http://www.uniprot.org/uniprot/O34651 O34651] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P63950 P63950] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9RSI4 Q9RSI4] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q02136 Q02136] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JTH9 Q9JTH9] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O30027 O30027] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PM77 Q9PM77] |
− | + | ** [http://www.uniprot.org/uniprot/P10370 P10370] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P06988 P06988] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/O66976 O66976] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q58851 Q58851] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O26327 O26327] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9X0D1 Q9X0D1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P18786 P18786] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P28736 P28736] |
+ | ** [http://www.uniprot.org/uniprot/P45353 P45353] | ||
+ | ** [http://www.uniprot.org/uniprot/Q12670 Q12670] | ||
+ | ** [http://www.uniprot.org/uniprot/P72946 P72946] | ||
+ | ** [http://www.uniprot.org/uniprot/P73058 P73058] | ||
+ | ** [http://www.uniprot.org/uniprot/P00815 P00815] | ||
+ | ** [http://www.uniprot.org/uniprot/P07685 P07685] | ||
+ | ** [http://www.uniprot.org/uniprot/P16245 P16245] | ||
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R01163 R01163] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=histidinol dehydrogenase}} | ||
+ | {{#set: gene associated=CHC_T00008451001_1|CHC_T00008451001}} | ||
+ | {{#set: in pathway=HISTSYN-PWY}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 17:38, 9 January 2019
Contents
Reaction HISTALDEHYD-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- histidinol dehydrogenase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NAD+[c] + 1 H2O[c] + 1 histidinal[c] => 2 H+[c] + 1 L-histidine[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008451001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008451001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- HISTSYN-PWY, L-histidine biosynthesis: HISTSYN-PWY
- 10 reactions found over 10 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
- RHEA:
- UNIPROT:
- LIGAND-RXN: