Difference between revisions of "CPD-7221"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11717 RXN-11717] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11717 RXN-11717] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.2.1 EC-4.2.1]
+
** 943.792   
 +
* inchi key:
 +
** InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J
 +
* common name:
 +
** 3-cis-dodecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 12:1(n-9)
 +
** 12:1 cis-3
 +
** cis-3-dodecenoyl-CoA
 +
** (3Z)-dodecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-12673]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-11020]][c]
+
* [[RXN-14394]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 5-chloro-5-deoxy-D-ribonate[c] '''=>''' 1 H2O[c] '''+''' 1 5-chloro-4-hydroxy-2-oxopentanoate[c]
+
* [[RXN-7931]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009385001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-6627]], salinosporamide A biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6627 PWY-6627]
+
−
** '''2''' reactions found over '''15''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-4.2.1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27989 27989]
−
{{#set: gene associated=CHC_T00009385001_1}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-6627}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659197 90659197]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02944 C02944]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* HMDB : HMDB04257
 +
{{#set: smiles=CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O}}
 +
{{#set: molecular weight=943.792    }}
 +
{{#set: inchi key=InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J}}
 +
{{#set: common name=3-cis-dodecenoyl-CoA}}
 +
{{#set: common name=12:1(n-9)|12:1 cis-3|cis-3-dodecenoyl-CoA|(3Z)-dodecenoyl-CoA}}
 +
{{#set: produced by=RXN-14394}}
 +
{{#set: reversible reaction associated=RXN-7931}}

Latest revision as of 17:41, 9 January 2019

Metabolite CPD-7221

  • smiles:
    • CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O
  • molecular weight:
    • 943.792
  • inchi key:
    • InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J
  • common name:
    • 3-cis-dodecenoyl-CoA
  • Synonym(s):
    • 12:1(n-9)
    • 12:1 cis-3
    • cis-3-dodecenoyl-CoA
    • (3Z)-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-7221&oldid=23398"