Difference between revisions of "CPD-308"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1147 RXN0-1147] == * direction: ** REVERSIBLE * common name: ** 2-oxoglutarate dehydrogenase,...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1147 RXN0-1147] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
 +
* molecular weight:
 +
** 303.294   
 +
* inchi key:
 +
** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
 
* common name:
 
* common name:
−
** 2-oxoglutarate dehydrogenase, E1 component
+
** D-nopaline
−
** dihydrolipoamide dehydrogenase
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.3.1.61 EC-2.3.1.61]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** N2-(D-1,3-dicarboxypropyl)-L-arginine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Oxo-glutarate-dehydrogenase-DH-lipoyl]][c] '''+''' 1 [[SUC-COA]][c] '''<=>''' 1 [[Oxo-glutarate-dehydro-suc-DH-lipoyl]][c] '''+''' 1 [[CO-A]][c]
+
* [[1.5.1.19-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a [2-oxoglutarate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine[c] '''+''' 1 succinyl-CoA[c] '''<=>''' 1 a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine[c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008441001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008441001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00008312001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00010287001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00008312001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00010023001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
+
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-5084]], 2-oxoglutarate decarboxylation to succinyl-CoA: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5084 PWY-5084]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01940 R01940]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074]
−
** [http://www.genome.jp/dbget-bin/www_bget?R02570 R02570]
+
* PUBCHEM:
−
{{#set: direction=REVERSIBLE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983]
−
{{#set: common name=2-oxoglutarate dehydrogenase, E1 component}}
+
* LIGAND-CPD:
−
{{#set: common name=dihydrolipoamide dehydrogenase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682]
−
{{#set: ec number=EC-2.3.1.61}}
+
{{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}}
−
{{#set: gene associated=CHC_T00008441001|CHC_T00008441001_1|CHC_T00008312001|CHC_T00010287001_1|CHC_T00008312001_1|CHC_T00010023001_1}}
+
{{#set: molecular weight=303.294    }}
−
{{#set: in pathway=PWY66-398|PWY-5084}}
+
{{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=D-nopaline}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: produced by=1.5.1.19-RXN}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 17:42, 9 January 2019

Metabolite CPD-308

  • smiles:
    • C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
  • molecular weight:
    • 303.294
  • inchi key:
    • InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
  • common name:
    • D-nopaline
  • Synonym(s):
    • N2-(D-1,3-dicarboxypropyl)-L-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-308&oldid=23400"