Difference between revisions of "Propionyl-CoA-CO2-ligases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] == * common name: ** [propionyl-CoA:carbon...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] ==
* smiles:
+
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
+
* inchi key:
+
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
+
 
* common name:
 
* common name:
** queuine
+
** [propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
* molecular weight:
+
** 278.29   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 
** base Q
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[6.3.4.10-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=[propionyl-CoA:carbon-dioxide ligase (ADP-forming)]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
+
{{#set: produced by=6.3.4.10-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
+
* HMDB : HMDB01495
+
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
+
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
+
{{#set: common name=queuine}}
+
{{#set: molecular weight=278.29    }}
+
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}}
+
{{#set: consumed or produced by=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
+

Latest revision as of 16:46, 23 May 2018

Metabolite Propionyl-CoA-CO2-ligases

  • common name:
    • [propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links