Difference between revisions of "PWY-7143"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7143 PWY-7143] ==
* smiles:
+
** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
* inchi key:
+
** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxydecanoyl-CoA
+
** kaempferol gentiobioside biosynthesis
* molecular weight:
+
* taxonomic range:
** 933.753   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12490]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN1F-461]]
* [[RXN-13616]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00001656001_1]]
 +
*** [[CHC_T00003244001_1]]
 +
*** [[CHC_T00000989001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13830 RXN-13830]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=kaempferol gentiobioside biosynthesis}}
** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264]
+
{{#set: taxonomic range=TAX-3398}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616]
+
{{#set: total reaction=2}}
* BIGG : 3hdcoa
+
{{#set: completion rate=50.0}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629]
+
* HMDB : HMDB03938
+
{{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}}
+
{{#set: common name=(S)-3-hydroxydecanoyl-CoA}}
+
{{#set: molecular weight=933.753    }}
+
{{#set: consumed by=RXN-12490}}
+
{{#set: produced by=RXN-13616}}
+

Latest revision as of 15:58, 9 January 2019

Pathway PWY-7143

  • common name:
    • kaempferol gentiobioside biosynthesis
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links