Difference between revisions of "CHC T00008455001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * inchi key: ** InChIKey=NU...") |
(Created page with "Category:Gene == Gene CHC_T00008455001 == * left end position: ** 223738 * transcription direction: ** POSITIVE * right end position: ** 225142 * centisome position: ** 43...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008455001 == |
− | * | + | * left end position: |
− | ** | + | ** 223738 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 225142 |
− | * | + | * centisome position: |
− | ** | + | ** 43.229633 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=223738}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=225142}} | |
− | + | {{#set: centisome position=43.229633 }} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 17:46, 23 May 2018
Gene CHC_T00008455001
- left end position:
- 223738
- transcription direction:
- POSITIVE
- right end position:
- 225142
- centisome position:
- 43.229633
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome