Difference between revisions of "CPD-2041"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00007701001_1 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-galdieria.sulphuraria * RXN-15559 ** pant...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2041 CPD-2041] == |
| + | * smiles: | ||
| + | ** CC(C)C([N+])CC([O-])=O | ||
| + | * molecular weight: | ||
| + | ** 131.174 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GLUJNGJDHCTUJY-RXMQYKEDSA-N | ||
| + | * common name: | ||
| + | ** (3R)-β-leucine | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** β-homovaline | ||
| + | ** (3R)-β-2-amino-4-methylvaleric acid | ||
| + | ** L-β-leucine | ||
| + | ** 3-amino-4-methylpentanoate | ||
| + | ** β-leucine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-7690]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[LEUCINE-23-AMINOMUTASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57428 57428] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6934188 6934188] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02486 C02486] | ||
| + | * HMDB : HMDB03640 | ||
| + | {{#set: smiles=CC(C)C([N+])CC([O-])=O}} | ||
| + | {{#set: molecular weight=131.174 }} | ||
| + | {{#set: inchi key=InChIKey=GLUJNGJDHCTUJY-RXMQYKEDSA-N}} | ||
| + | {{#set: common name=(3R)-β-leucine}} | ||
| + | {{#set: common name=β-homovaline|(3R)-β-2-amino-4-methylvaleric acid|L-β-leucine|3-amino-4-methylpentanoate|β-leucine}} | ||
| + | {{#set: consumed by=RXN-7690}} | ||
| + | {{#set: reversible reaction associated=LEUCINE-23-AMINOMUTASE-RXN}} | ||
Latest revision as of 17:43, 9 January 2019
Contents
Metabolite CPD-2041
- smiles:
- CC(C)C([N+])CC([O-])=O
- molecular weight:
- 131.174
- inchi key:
- InChIKey=GLUJNGJDHCTUJY-RXMQYKEDSA-N
- common name:
- (3R)-β-leucine
- Synonym(s):
- β-homovaline
- (3R)-β-2-amino-4-methylvaleric acid
- L-β-leucine
- 3-amino-4-methylpentanoate
- β-leucine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C([N+])CC([O-])=O" cannot be used as a page name in this wiki.
