Difference between revisions of "CPD-14780"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_COB-I-ALAMIN ExchangeSeed_COB-I-ALAMIN] == * direction: ** REVERSIBLE * Synonym(s): =...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14780 CPD-14780] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(OC(C(C(C1O)O)O)=O) |
+ | * molecular weight: | ||
+ | ** 178.141 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PHOQVHQSTUBQQK-MBMOQRBOSA-N | ||
+ | * common name: | ||
+ | ** D-mannono-1,5-lactone | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** D-mannonic acid δ-lactone | ||
+ | ** (3S,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one | ||
+ | ** mannono-δ-lactone | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-13741]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151504 151504] |
− | {{#set: | + | * DRUGBANK : DB01885 |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.133528.html 133528] | ||
+ | {{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}} | ||
+ | {{#set: molecular weight=178.141 }} | ||
+ | {{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-MBMOQRBOSA-N}} | ||
+ | {{#set: common name=D-mannono-1,5-lactone}} | ||
+ | {{#set: common name=D-mannonic acid δ-lactone|(3S,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one|mannono-δ-lactone}} | ||
+ | {{#set: produced by=RXN-13741}} |
Latest revision as of 18:43, 9 January 2019
Contents
Metabolite CPD-14780
- smiles:
- C(O)C1(OC(C(C(C1O)O)O)=O)
- molecular weight:
- 178.141
- inchi key:
- InChIKey=PHOQVHQSTUBQQK-MBMOQRBOSA-N
- common name:
- D-mannono-1,5-lactone
- Synonym(s):
- D-mannonic acid δ-lactone
- (3S,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one
- mannono-δ-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links