Difference between revisions of "DIHYDROXY-BUTANONE-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9633 RXN-9633] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-stearoyl-[acyl-carrier...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9633 RXN-9633] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)C(O)COP(=O)([O-])[O-]
 +
* molecular weight:
 +
** 182.069   
 +
* inchi key:
 +
** InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
 
* common name:
 
* common name:
−
** 3-oxo-stearoyl-[acyl-carrier protein] reductase
+
** 1-deoxy-L-glycero-tetrulose 4-phosphate
−
** 3-oxoacyl-[acyl-carrier-protein] reductase
+
−
** 3-oxoacyl-(acyl-carrier-protein) reductase
+
−
** beta-ketoacyl reductase
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,4-dihydroxy-2-butanone-4-phosphate
 +
** tetrolose phosphate
 +
** 3,4-dihydroxy-2-butanone-4-P
 +
** L-3,4-dihydroxybutan-2-one-4-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[LUMAZINESYN-RXN]]
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-oxo-stearoyl-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[R-3-hydroxystearoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[DIOHBUTANONEPSYN-RXN]]
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a 3-oxo-stearoyl-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxystearoyl-[acp][c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008517001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00008477001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008496001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008557001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY3O-355]], stearate biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-355 PWY3O-355]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=3-oxo-stearoyl-[acyl-carrier protein] reductase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50606 50606]
−
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] reductase}}
+
* BIGG : db4p
−
{{#set: common name=3-oxoacyl-(acyl-carrier-protein) reductase}}
+
* PUBCHEM:
−
{{#set: common name=beta-ketoacyl reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658385 90658385]
−
{{#set: ec number=EC-2.3.1.86}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.1.1.100}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15556 C15556]
−
{{#set: gene associated=CHC_T00008517001_1|CHC_T00008477001|CHC_T00008496001|CHC_T00008557001}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-5989|PWY3O-355}}
+
** [http://www.chemspider.com/Chemical-Structure.10739351.html 10739351]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CC(=O)C(O)COP(=O)([O-])[O-]}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=182.069    }}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: inchi key=InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=1-deoxy-L-glycero-tetrulose 4-phosphate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=3,4-dihydroxy-2-butanone-4-phosphate|tetrolose phosphate|3,4-dihydroxy-2-butanone-4-P|L-3,4-dihydroxybutan-2-one-4-phosphate}}
−
{{#set: reconstruction source=original_genome}}
+
{{#set: consumed by=LUMAZINESYN-RXN}}
 +
{{#set: produced by=DIOHBUTANONEPSYN-RXN}}

Latest revision as of 18:44, 9 January 2019

Metabolite DIHYDROXY-BUTANONE-P

  • smiles:
    • CC(=O)C(O)COP(=O)([O-])[O-]
  • molecular weight:
    • 182.069
  • inchi key:
    • InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
  • common name:
    • 1-deoxy-L-glycero-tetrulose 4-phosphate
  • Synonym(s):
    • 3,4-dihydroxy-2-butanone-4-phosphate
    • tetrolose phosphate
    • 3,4-dihydroxy-2-butanone-4-P
    • L-3,4-dihydroxybutan-2-one-4-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)C(O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=DIHYDROXY-BUTANONE-P&oldid=23441"