Difference between revisions of "CHC T00008789001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008789001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PEPSYNTH-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | == | + | * Reaction: [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]] |
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7117]] | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[PWY-5484]] | ||
+ | * [[PWY-241]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[P23-PWY]] | ||
+ | * [[PWY-6549]] | ||
+ | * [[GLUCONEO-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=PEPSYNTH-RXN|PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7117|GLYCOLYSIS|PWY-5484|PWY-241|PWY-7115|P23-PWY|PWY-6549|GLUCONEO-PWY}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 18:37, 9 January 2019
Gene CHC_T00008789001_1
- Synonym(s):
Reactions associated
- Reaction: PEPSYNTH-RXN
- Source: orthology-galdieria.sulphuraria
- Reaction: PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN
- Source: orthology-galdieria.sulphuraria