Difference between revisions of "MANNOSE-1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9524 RXN-9524] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-octanoyl-[acyl-carrier...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9524 RXN-9524] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
 +
* molecular weight:
 +
** 258.121   
 +
* inchi key:
 +
** InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
 
* common name:
 
* common name:
** 3-oxo-octanoyl-[acyl-carrier protein] reductase
+
** α-D-mannose 1-phosphate
** 3-oxoacyl-(acyl-carrier-protein) reductase
+
** beta-ketoacyl reductase
+
** 3-oxoacyl-[acyl-carrier-protein] reductase
+
* ec number:
+
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** mannose-1-phosphate
 +
** D-mannose-1-phosphate
 +
** mannose-1-P
 +
** α-D-mannopyranose 1-phosphate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[2.7.7.13-RXN]]
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-Oxo-octanoyl-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[3-Hydroxy-octanoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a 3-oxo-octanoyl-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxyoctanoyl-[acp][c]
+
* [[MANNPGUANYLTRANGDP-RXN]]
 
+
* [[PHOSMANMUT-RXN]]
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008477001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00008496001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00008517001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00008557001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
** '''31''' reactions found over '''31''' reactions in the full pathway
+
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
** '''22''' reactions found over '''31''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* BIGG : man1p
{{#set: common name=3-oxo-octanoyl-[acyl-carrier protein] reductase}}
+
* CAS : 27251-84-9
{{#set: common name=3-oxoacyl-(acyl-carrier-protein) reductase}}
+
* HMDB : HMDB06330
{{#set: common name=beta-ketoacyl reductase}}
+
* CHEBI:
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] reductase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409]
{{#set: ec number=EC-2.3.1.86}}
+
* LIGAND-CPD:
{{#set: ec number=EC-2.3.1.85}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00636 C00636]
{{#set: ec number=EC-1.1.1.100}}
+
* PUBCHEM:
{{#set: gene associated=CHC_T00008477001|CHC_T00008496001|CHC_T00008517001_1|CHC_T00008557001}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607]
{{#set: in pathway=PWY-5971|PWY-5994}}
+
{{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=258.121    }}
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L}}
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=α-D-mannose 1-phosphate}}
{{#set: reconstruction category=annotation}}
+
{{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P|α-D-mannopyranose 1-phosphate}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=2.7.7.13-RXN}}
{{#set: reconstruction source=original_genome}}
+
{{#set: reversible reaction associated=MANNPGUANYLTRANGDP-RXN|PHOSMANMUT-RXN}}

Latest revision as of 18:44, 9 January 2019

Metabolite MANNOSE-1P

  • smiles:
    • C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
  • molecular weight:
    • 258.121
  • inchi key:
    • InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
  • common name:
    • α-D-mannose 1-phosphate
  • Synonym(s):
    • mannose-1-phosphate
    • D-mannose-1-phosphate
    • mannose-1-P
    • α-D-mannopyranose 1-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • BIGG : man1p
  • CAS : 27251-84-9
  • HMDB : HMDB06330
  • CHEBI:
  • LIGAND-CPD:
  • PUBCHEM:
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.